| Identification | Back Directory | [Name]
DICHLOROBIS(TRICYCLOHEXYLPHOSPHINE)PALLADIUM(II) | [CAS]
29934-17-6 | [Synonyms]
PdCl2[P(cy)3]2 Dichlorobis(tricyclohexylphosp Dichloro(tricyclohexylphosphine)palladium (II) trans-Dichlorobis(tricyclohexylphosphine)palla Dichlorobis(tricyclohexylphosphine)palladium(Ⅱ) DICHLOROBIS(TRICYCLOHEXYLPHOSPHINE)PALLADIUM(II) dichlorobis(tricyclohexylphophine)palladium (ii) bis(tricyclohexylphosphine)palladium(II) chloride Bis(tricyclohexylphosphine)palladium(II)Dichlorid Bis (tricyclohexylphosphine) palladiuM dichloride BIS(TRICYCLOHEXYLPHOSPHINE)PALLADIUM(II) DICHLORIDE Dichlorobis(tricyclohexylphosphine)palladium(II),99% TRANS-DICHLOROBIS-(TRICYCLOHEXYLPHOSPHINE)-PALLADIUM TRANS-DICHLOROBIS(TRICYCLOHEXYLPHOSPHINE)PALLADIUM(II) Dichlorobis(tricyclohexylphosphine)palladium (II) ,98% Dichlorobis(tricyclohexylphosphine)palladium(II), Pd 14.4% trans-Dichlorobis(tricyclohexylphosphine)palladium(II),99% trans-Dichlorobis(tricyclohexylphosphine)palladiuM(II),98% (PCy3)2PdCl2 Dichlorobis(tricyclohexylphosphine)palladiuM(Ⅱ), 14% Pd, Product of UMicore trans-Dichlorobis(tricyclohexylphosphino)palladium(II)/potassium phosphate admixture [Catkit single-use vials-6.62 wt% Pd complex] | [EINECS(EC#)]
476-300-4 | [Molecular Formula]
C36H66Cl2P2Pd | [MDL Number]
MFCD00191830 | [MOL File]
29934-17-6.mol | [Molecular Weight]
738.18 |
| Chemical Properties | Back Directory | [Appearance]
Yellow powder | [Melting point ]
270 °C (dec.)(lit.)
| [density ]
6.473 | [storage temp. ]
<0°C | [form ]
Powder | [color ]
Yellow | [Water Solubility ]
Moderately soluble in dichloromethane and chloroform. Sparingly soluble in benzene and toluene. Insoluble in water, alcohols, acetone, diethyl ether, andhexanes. | [InChI]
InChI=1S/2C18H33P.2ClH.Pd/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*16-18H,1-15H2;2*1H;/q;;;;+2/p-2 | [InChIKey]
KHXRPVIZRSHDNN-UHFFFAOYSA-N | [SMILES]
P(C1CCCCC1)(C1CCCCC1)C1CCCCC1.P(C1CCCCC1)(C1CCCCC1)C1CCCCC1.[Pd](Cl)Cl | [CAS DataBase Reference]
29934-17-6 |
| Hazard Information | Back Directory | [Chemical Properties]
Yellow powder | [Usage]
suzuki reaction | [Uses]
suzuki reaction | [General Description]
Dichlorobis(tricyclohexylphosphine)palladium(II)(Cas:29934-17-6) is widely employed as catalyst precursor in various carbon-carbon and carbon-heteroatom bond forming reactions.
| [reaction suitability]
core: palladium reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Cross Couplings reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst | [Synthesis]
Bis(tricyclohexylphosphine)palladium(II) Dichloride is prepared by reacting Tricyclohexyl phosphine with Palladium chloride refluxed in acetone for 3h. |
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Telephone: |
18210857532 18210857532 |
| Website: |
https://www.jkchemical.com |
| Company Name: |
Alfa Aesar
|
| Telephone: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Jia Xing Isenchem Co.,Ltd
|
| Telephone: |
0573-85285100 18627885956 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList14265/0_EN.htm |
| Company Name: |
Maya High Purity Chemicals
|
| Telephone: |
+86 (573) 82222445 (0)18006601000 452520369 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15221/0_EN.htm |
|