- L-Lys-oet.2HCl
-
- $0.00 / 1kg
-
2026-04-28
- CAS:3844-53-9
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | Ethyl 2,6-diaminohexanoate dihydrochloride Basic information |
| | Ethyl 2,6-diaminohexanoate dihydrochloride Chemical Properties |
| Melting point | ~150 °C (dec.) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Aqueous Acid (Slightly, Heated), Water (Sparingly) | | form | Solid | | color | Off-White | | Optical Rotation | [α]20/D +10±1°, c = 2% in H2O | | Sensitive | Hygroscopic | | BRN | 3697099 | | Major Application | peptide synthesis | | InChI | 1S/C8H18N2O2.2ClH/c1-2-12-8(11)7(10)5-3-4-6-9;;/h7H,2-6,9-10H2,1H3;2*1H/t7-;;/m0../s1 | | InChIKey | DZIYAIZKJOHVQC-KLXURFKVSA-N | | SMILES | Cl.Cl.CCOC(=O)[C@@H](N)CCCCN | | CAS DataBase Reference | 3844-53-9(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3 | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids |
| | Ethyl 2,6-diaminohexanoate dihydrochloride Usage And Synthesis |
| Chemical Properties | White powder | | Uses | L-Lysine Ethyl Ester Dihydrochloride is a reagent used in the preparation of myxochelin which has been shown to possess strong anti-tumor activity. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Ethyl 2,6-diaminohexanoate dihydrochloride Preparation Products And Raw materials |
|