Fendizoic acid
|
|
Fendizoic acid 속성
- 녹는점
- 262-264 °C
- 끓는 점
- 593.9±50.0 °C(Predicted)
- 밀도
- 1.305
- 저장 조건
- -20°C Freezer, Under inert atmosphere
- 용해도
- DMSO(약간 용해됨), 메탄올(약간 용해됨, 가열)
- 산도 계수 (pKa)
- 3.28±0.36(Predicted)
- 물리적 상태
- 고체
- 물리적 상태
- 단단한 모양
- 색상
- 흰색에서 연한 노란색
- InChI
- InChI=1S/C20H14O4/c21-18-11-10-14(12-17(18)13-6-2-1-3-7-13)19(22)15-8-4-5-9-16(15)20(23)24/h1-12,21H,(H,23,24)
- InChIKey
- PKHPZNKXOBWFCX-UHFFFAOYSA-N
- SMILES
- C(O)(=O)C1=CC=CC=C1C(C1C=CC(O)=C(C2=CC=CC=C2)C=1)=O
안전
- 위험 및 안전 성명
- 위험 및 사전주의 사항 (GHS)
| 그림문자(GHS): |
|
||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 신호 어: | Warning | ||||||||||||||||||||||||||||
| 유해·위험 문구: |
|
||||||||||||||||||||||||||||
| 예방조치문구: |
|
Fendizoic acid C화학적 특성, 용도, 생산
용도
Fendizoic Acid is a reagent in the synthesis of fluorinated polyphthalazinone ethers containing perfluorophenylene moieties.Fendizoic acid 준비 용품 및 원자재
원자재
준비 용품
Fendizoic acid 공급 업체
글로벌( 89)공급 업체
| 공급자 | 전화 | 이메일 | 국가 | 제품 수 | 이점 |
|---|---|---|---|---|---|
| Chongqing Ensky Pharmaceutical Co.,Ltd. | +86-23-86815286 +86-13983794297 |
sales@ensky-chemical.com | China | 91 | 58 |
| Chemsigma International Co., Ltd. | +86-18136843612 +86-19951791336 |
info@chemsigma.com | China | 1342 | 58 |
| Jiangsu Boquan Biotechnology Co., Ltd. | +86-18168774353 |
boquanshengwu003@boquansw.com | China | 248 | 58 |
| Nanjing Triumpharm Co.,Ltd | +86-02586182925 +86-15105172550 |
info@triumpharm.com | China | 129 | 58 |
| SHANGHAI KEAN TECHNOLOGY CO., LTD. | +8613817748580 |
cooperation@kean-chem.com | China | 40068 | 58 |
| Hebei Chuanghai Biotechnology Co,.LTD | +86-13131129325 |
sales1@chuanghaibio.com | China | 5892 | 58 |
| airuikechemical co., ltd. | +undefined86-15315557071 |
sales02@sdzhonghuimaterial.com | China | 983 | 58 |
| Henan Tianfu Chemical Co.,Ltd. | +86-0371-55170693 +86-19937530512 |
info@tianfuchem.com | China | 21666 | 55 |
| Shandong chuangyingchemical Co., Ltd. | 18853181302 |
sale@chuangyingchem.com | CHINA | 5909 | 58 |
| career henan chemical co | +86-0371-86658258 +8613203830695 |
factory@coreychem.com | China | 29822 | 58 |