- Cephalonium
-
- $98.00
-
2026-07-14
- CAS:5575-21-3
- Purity: 99.36%
- Supply Ability: 10g
- Cephalonium
-
- $98.00
-
2026-07-14
- CAS:5575-21-3
- Purity: 99.36%
- Supply Ability: 10g
- Cephalonium
-
- $182.00
-
2025-04-28
- CAS:5575-21-3
- Purity: 99.36%
- Supply Ability: 10g
|
| | Cephalonium Basic information |
| Product Name: | Cephalonium | | Synonyms: | Pyridinium, 4-(aminocarbonyl)-1-(6R,7R)-2-carboxy-8-oxo-7-(2-thienylacetyl)amino-5-thia-1-azabicyclo4.2.0oct-2-en-3-ylmethyl-, inner salt;(6R,7R)-3-[(4-Carbamoylpyridin-1-ium-1-yl)methyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;Cephalonium;(6R,7R)-3-[(4-Carbamoylpyridinio)methyl]-8-oxo-7-[2-(2-thienyl)acetylamino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;(6R,7R)-3-[(4-aminocarbonylpyridin-1-ium-1-yl)methyl]-8-oxo-7-(2-thiophen-2-ylethanoylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;(6R,7R)-3-[(4-carbamoylpyridin-1-ium-1-yl)methyl]-8-keto-7-[[2-(2-thienyl)acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;(6R,7R)-3-[(4-Carbamoylpyridinio)methyl]-8-oxo-7-[2-(2-thienyl)acetylamino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate hydrate;Cephalonium USP/EP/BP | | CAS: | 5575-21-3 | | MF: | C20H18N4O5S2 | | MW: | 458.51 | | EINECS: | 226-948-7 | | Product Categories: | | | Mol File: | 5575-21-3.mol |  |
| | Cephalonium Chemical Properties |
| Melting point | 147-150° (dec) | | storage temp. | 2-8°C | | solubility | DMSO: 25 mg/ml,DMSO:PBS (pH 7.2) (1:10): 0.09 mg/ml | | pka | 3.3(at 25℃) | | Major Application | clinical testing | | InChIKey | GVIOXNHDFXYYMP-AEFICSSHSA-N | | SMILES | O.NC(=O)c1cc[n+](CC2=C(N3[C@H](SC2)[C@H](NC(=O)Cc4cccs4)C3=O)C([O-])=O)cc1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Cephalonium Usage And Synthesis |
| Chemical Properties | Cephalonium is Off-White to Pale Beige Solid | | Uses | Cephalonium is a first-generation cephalosporin antibiotic used as a long-acting intramammary cerate for infusion of dairy cows. | | Uses | antibacterial | | Definition | ChEBI: (6R,7R)-3-[(4-carbamoyl-1-pyridin-1-iumyl)methyl]-8-oxo-7-[(1-oxo-2-thiophen-2-ylethyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate is a cephalosporin. |
| | Cephalonium Preparation Products And Raw materials |
|